C64H92O10 — CID 58914146
[4-[(E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoyl]oxynaphthalen-1-yl] (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate (PubChem CID 58914146) has the molecular formula C64H92O10 and a molecular weight of 1021.43 g/mol. Its IUPAC name is [4-[(E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoyl]oxynaphthalen-1-yl] (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate.
| Compound Name | [4-[(E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoyl]oxynaphthalen-1-yl] (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 58914146 |
| Molecular Formula | C64H92O10 |
| Molecular Weight | 1021.43 g/mol |
| Exact Mass | 1020.67 |
| IUPAC Name | [4-[(E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoyl]oxynaphthalen-1-yl] (E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoate |
| SMILES | CCCCCCOc1ccc(/C=C/C(=O)Oc2ccc(OC(=O)/C=C/c3ccc(OCCCCCC)c(OCCCCCC)c3OCCCCCC)c3ccccc23)c(OCCCCCC)c1OCCCCCC |
| InChI | InChI=1S/C64H92O10/c1-7-13-19-27-45-67-57-39-35-51(61(69-47-29-21-15-9-3)63(57)71-49-31-23-17-11-5)37-43-59(65)73-55-41-42-56(54-34-26-25-33-53(54)55)74-60(66)44-38-52-36-40-58(68-46-28-20-14-8-2)64(72-50-32-24-18-12-6)62(52)70-48-30-22-16-10-4/h25-26,33-44H,7-24,27-32,45-50H2,1-6H3/b43-37+,44-38+ |
| InChIKey | BUHUANVSAWHWOQ-IURZCWNESA-N |
| XLogP | 17.83 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 74 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1021.43 |
| LogP ≤ 5 | 17.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|