C63H94O12 — CID 58764566
[1-[2,3-dihexoxy-4-[(E)-3-oxo-3-[4-[(E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoyl]oxyphenoxy]prop-1-enyl]phenyl]-4-hydroxybutyl] 2-methylbutanoate (PubChem CID 58764566) has the molecular formula C63H94O12 and a molecular weight of 1043.43 g/mol. Its IUPAC name is [1-[2,3-dihexoxy-4-[(E)-3-oxo-3-[4-[(E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoyl]oxyphenoxy]prop-1-enyl]phenyl]-4-hydroxybutyl] 2-methylbutanoate.
| Compound Name | [1-[2,3-dihexoxy-4-[(E)-3-oxo-3-[4-[(E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoyl]oxyphenoxy]prop-1-enyl]phenyl]-4-hydroxybutyl] 2-methylbutanoate |
|---|---|
| PubChem CID | 58764566 |
| Molecular Formula | C63H94O12 |
| Molecular Weight | 1043.43 g/mol |
| Exact Mass | 1042.67 |
| IUPAC Name | [1-[2,3-dihexoxy-4-[(E)-3-oxo-3-[4-[(E)-3-(2,3,4-trihexoxyphenyl)prop-2-enoyl]oxyphenoxy]prop-1-enyl]phenyl]-4-hydroxybutyl] 2-methylbutanoate |
| SMILES | CCCCCCOc1ccc(/C=C/C(=O)Oc2ccc(OC(=O)/C=C/c3ccc(C(CCCO)OC(=O)C(C)CC)c(OCCCCCC)c3OCCCCCC)cc2)c(OCCCCCC)c1OCCCCCC |
| InChI | InChI=1S/C63H94O12/c1-8-14-19-24-44-68-56-40-32-51(60(70-46-26-21-16-10-3)62(56)72-48-28-23-18-12-5)34-42-58(66)74-53-37-35-52(36-38-53)73-57(65)41-33-50-31-39-54(55(30-29-43-64)75-63(67)49(7)13-6)61(71-47-27-22-17-11-4)59(50)69-45-25-20-15-9-2/h31-42,49,55,64H,8-30,43-48H2,1-7H3/b41-33+,42-34+ |
| InChIKey | RNWAERDGSVUESJ-CACZWXESSA-N |
| XLogP | 16.12 |
| TPSA | 145.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 75 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1043.43 |
| LogP ≤ 5 | 16.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|