C68H102O14 — CID 72656068
1-O-[1-[2,3-dihexoxy-4-[3-oxo-3-[4-[3-(2,3,4-trihexoxyphenyl)prop-2-enoyloxy]phenoxy]prop-1-enyl]phenyl]-4-hydroxybutyl] 5-O-methyl 4-ethyl-2,2-dimethylpentanedioate (PubChem CID 72656068) has the molecular formula C68H102O14 and a molecular weight of 1143.55 g/mol. Its IUPAC name is 1-O-[1-[2,3-dihexoxy-4-[3-oxo-3-[4-[3-(2,3,4-trihexoxyphenyl)prop-2-enoyloxy]phenoxy]prop-1-enyl]phenyl]-4-hydroxybutyl] 5-O-methyl 4-ethyl-2,2-dimethylpentanedioate.
| Compound Name | 1-O-[1-[2,3-dihexoxy-4-[3-oxo-3-[4-[3-(2,3,4-trihexoxyphenyl)prop-2-enoyloxy]phenoxy]prop-1-enyl]phenyl]-4-hydroxybutyl] 5-O-methyl 4-ethyl-2,2-dimethylpentanedioate |
|---|---|
| PubChem CID | 72656068 |
| Molecular Formula | C68H102O14 |
| Molecular Weight | 1143.55 g/mol |
| Exact Mass | 1142.73 |
| IUPAC Name | 1-O-[1-[2,3-dihexoxy-4-[3-oxo-3-[4-[3-(2,3,4-trihexoxyphenyl)prop-2-enoyloxy]phenoxy]prop-1-enyl]phenyl]-4-hydroxybutyl] 5-O-methyl 4-ethyl-2,2-dimethylpentanedioate |
| SMILES | CCCCCCOc1ccc(C=CC(=O)Oc2ccc(OC(=O)C=Cc3ccc(C(CCCO)OC(=O)C(C)(C)CC(CC)C(=O)OC)c(OCCCCCC)c3OCCCCCC)cc2)c(OCCCCCC)c1OCCCCCC |
| InChI | InChI=1S/C68H102O14/c1-10-16-21-26-46-75-59-42-34-54(63(77-48-28-23-18-12-3)65(59)79-50-30-25-20-14-5)36-44-61(71)81-56-39-37-55(38-40-56)80-60(70)43-35-53-33-41-57(64(78-49-29-24-19-13-4)62(53)76-47-27-22-17-11-2)58(32-31-45-69)82-67(73)68(7,8)51-52(15-6)66(72)74-9/h33-44,52,58,69H,10-32,45-51H2,1-9H3 |
| InChIKey | MCXRJOBIDNTGQP-UHFFFAOYSA-N |
| XLogP | 16.69 |
| TPSA | 171.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1143.55 |
| LogP ≤ 5 | 16.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|