About 1,4-dibutoxynaphthalene
1,4-dibutoxynaphthalene (PubChem CID 22016411) has the molecular formula C18H24O2
and a molecular weight of 272.39 g/mol. Its IUPAC name is 1,4-dibutoxynaphthalene.
Molecular Properties
| Compound Name | 1,4-dibutoxynaphthalene |
| PubChem CID | 22016411 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | 1,4-dibutoxynaphthalene |
| SMILES | CCCCOc1ccc(OCCCC)c2ccccc12 |
| InChI | InChI=1S/C18H24O2/c1-3-5-13-19-17-11-12-18(20-14-6-4-2)16-10-8-7-9-15(16)17/h7-12H,3-6,13-14H2,1-2H3 |
| InChIKey | UKXGGMCMWNJILJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,4-dibutoxynaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-dibutoxynaphthalene?
The IUPAC name of 1,4-dibutoxynaphthalene (CID 22016411) is 1,4-dibutoxynaphthalene.
What is the SMILES notation for 1,4-dibutoxynaphthalene?
The canonical SMILES for 1,4-dibutoxynaphthalene is CCCCOc1ccc(OCCCC)c2ccccc12.
What is the InChIKey of 1,4-dibutoxynaphthalene?
The InChIKey is UKXGGMCMWNJILJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24O2/c1-3-5-13-19-17-11-12-18(20-14-6-4-2)16-10-8-7-9-15(16)17/h7-12H,3-6,13-14H2,1-2H3.
What are the key properties of 1,4-dibutoxynaphthalene?
1,4-dibutoxynaphthalene has a molecular weight of 272.39 g/mol, XLogP of 5.20, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dibutoxynaphthalene is sourced from PubChem (CID 22016411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).