C19H28O3 — CID 67747662
1-butoxynaphthalene;pentane-1,5-diol (PubChem CID 67747662) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is 1-butoxynaphthalene;pentane-1,5-diol.
| Compound Name | 1-butoxynaphthalene;pentane-1,5-diol |
|---|---|
| PubChem CID | 67747662 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | 1-butoxynaphthalene;pentane-1,5-diol |
| SMILES | CCCCOc1cccc2ccccc12.OCCCCCO |
| InChI | InChI=1S/C14H16O.C5H12O2/c1-2-3-11-15-14-10-6-8-12-7-4-5-9-13(12)14;6-4-2-1-3-5-7/h4-10H,2-3,11H2,1H3;6-7H,1-5H2 |
| InChIKey | MTHBYUZCWPOMRR-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|