C18H30O6 — CID 135239341
4-[2,3-bis(4-hydroxybutoxy)phenoxy]butan-1-ol (PubChem CID 135239341) has the molecular formula C18H30O6 and a molecular weight of 342.43 g/mol. Its IUPAC name is 4-[2,3-bis(4-hydroxybutoxy)phenoxy]butan-1-ol.
| Compound Name | 4-[2,3-bis(4-hydroxybutoxy)phenoxy]butan-1-ol |
|---|---|
| PubChem CID | 135239341 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | 4-[2,3-bis(4-hydroxybutoxy)phenoxy]butan-1-ol |
| SMILES | OCCCCOc1cccc(OCCCCO)c1OCCCCO |
| InChI | InChI=1S/C18H30O6/c19-10-1-4-13-22-16-8-7-9-17(23-14-5-2-11-20)18(16)24-15-6-3-12-21/h7-9,19-21H,1-6,10-15H2 |
| InChIKey | GLPMAVCYULNRNB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|