C20H26O — CID 174706158
3-methylbuta-1,2-diene;1-pentoxynaphthalene (PubChem CID 174706158) has the molecular formula C20H26O and a molecular weight of 282.43 g/mol. Its IUPAC name is 3-methylbuta-1,2-diene;1-pentoxynaphthalene.
| Compound Name | 3-methylbuta-1,2-diene;1-pentoxynaphthalene |
|---|---|
| PubChem CID | 174706158 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 3-methylbuta-1,2-diene;1-pentoxynaphthalene |
| SMILES | C=C=C(C)C.CCCCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C15H18O.C5H8/c1-2-3-6-12-16-15-11-7-9-13-8-4-5-10-14(13)15;1-4-5(2)3/h4-5,7-11H,2-3,6,12H2,1H3;1H2,2-3H3 |
| InChIKey | ZDBPFRJDOUDHKV-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|