C24H30O3 — CID 174693392
4-methylpenta-2,3-dien-2-yl prop-2-enoate;1-pentoxynaphthalene (PubChem CID 174693392) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is 4-methylpenta-2,3-dien-2-yl prop-2-enoate;1-pentoxynaphthalene.
| Compound Name | 4-methylpenta-2,3-dien-2-yl prop-2-enoate;1-pentoxynaphthalene |
|---|---|
| PubChem CID | 174693392 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 4-methylpenta-2,3-dien-2-yl prop-2-enoate;1-pentoxynaphthalene |
| SMILES | C=CC(=O)OC(C)=C=C(C)C.CCCCCOc1cccc2ccccc12 |
| InChI | InChI=1S/C15H18O.C9H12O2/c1-2-3-6-12-16-15-11-7-9-13-8-4-5-10-14(13)15;1-5-9(10)11-8(4)6-7(2)3/h4-5,7-11H,2-3,6,12H2,1H3;5H,1H2,2-4H3 |
| InChIKey | GRAWWMCREZKOIS-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|