C20H28O2 — CID 22144299
1,6-dipentoxynaphthalene (PubChem CID 22144299) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is 1,6-dipentoxynaphthalene.
| Compound Name | 1,6-dipentoxynaphthalene |
|---|---|
| PubChem CID | 22144299 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | 1,6-dipentoxynaphthalene |
| SMILES | CCCCCOc1ccc2c(OCCCCC)cccc2c1 |
| InChI | InChI=1S/C20H28O2/c1-3-5-7-14-21-18-12-13-19-17(16-18)10-9-11-20(19)22-15-8-6-4-2/h9-13,16H,3-8,14-15H2,1-2H3 |
| InChIKey | FBCLEBGYWLKKAY-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|