C31H40O3 — CID 57266006
(3R)-3-methyl-1-[4-[(6-octoxynaphthalen-1-yl)oxymethyl]phenyl]pentan-1-one (PubChem CID 57266006) has the molecular formula C31H40O3 and a molecular weight of 460.66 g/mol. Its IUPAC name is (3R)-3-methyl-1-[4-[(6-octoxynaphthalen-1-yl)oxymethyl]phenyl]pentan-1-one.
| Compound Name | (3R)-3-methyl-1-[4-[(6-octoxynaphthalen-1-yl)oxymethyl]phenyl]pentan-1-one |
|---|---|
| PubChem CID | 57266006 |
| Molecular Formula | C31H40O3 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | (3R)-3-methyl-1-[4-[(6-octoxynaphthalen-1-yl)oxymethyl]phenyl]pentan-1-one |
| SMILES | CCCCCCCCOc1ccc2c(OCc3ccc(C(=O)C[C@H](C)CC)cc3)cccc2c1 |
| InChI | InChI=1S/C31H40O3/c1-4-6-7-8-9-10-20-33-28-18-19-29-27(22-28)12-11-13-31(29)34-23-25-14-16-26(17-15-25)30(32)21-24(3)5-2/h11-19,22,24H,4-10,20-21,23H2,1-3H3/t24-/m1/s1 |
| InChIKey | IDWJJJVXHYCAJQ-XMMPIXPASA-N |
| XLogP | 8.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 8.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|