C34H46O3 — CID 14573552
[(2R)-2-methylbutyl] 4-[2-(6-decoxynaphthalen-2-yl)ethyl]benzoate (PubChem CID 14573552) has the molecular formula C34H46O3 and a molecular weight of 502.74 g/mol. Its IUPAC name is [(2R)-2-methylbutyl] 4-[2-(6-decoxynaphthalen-2-yl)ethyl]benzoate.
| Compound Name | [(2R)-2-methylbutyl] 4-[2-(6-decoxynaphthalen-2-yl)ethyl]benzoate |
|---|---|
| PubChem CID | 14573552 |
| Molecular Formula | C34H46O3 |
| Molecular Weight | 502.74 g/mol |
| Exact Mass | 502.34 |
| IUPAC Name | [(2R)-2-methylbutyl] 4-[2-(6-decoxynaphthalen-2-yl)ethyl]benzoate |
| SMILES | CCCCCCCCCCOc1ccc2cc(CCc3ccc(C(=O)OC[C@H](C)CC)cc3)ccc2c1 |
| InChI | InChI=1S/C34H46O3/c1-4-6-7-8-9-10-11-12-23-36-33-22-21-31-24-29(17-20-32(31)25-33)14-13-28-15-18-30(19-16-28)34(35)37-26-27(3)5-2/h15-22,24-25,27H,4-14,23,26H2,1-3H3/t27-/m1/s1 |
| InChIKey | WMJIVVIPTCWTBR-HHHXNRCGSA-N |
| XLogP | 9.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.74 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|