C62H92O16 — CID 58764659
[4-[(E)-3-[2-hexoxy-3,4-bis(4-prop-2-enylperoxybutoxy)phenyl]prop-2-enoyl]oxycyclohexyl] (E)-3-[3,4-bis(4-ethenoxybutoxy)-2-hexoxyphenyl]prop-2-enoate (PubChem CID 58764659) has the molecular formula C62H92O16 and a molecular weight of 1093.40 g/mol. Its IUPAC name is [4-[(E)-3-[2-hexoxy-3,4-bis(4-prop-2-enylperoxybutoxy)phenyl]prop-2-enoyl]oxycyclohexyl] (E)-3-[3,4-bis(4-ethenoxybutoxy)-2-hexoxyphenyl]prop-2-enoate.
| Compound Name | [4-[(E)-3-[2-hexoxy-3,4-bis(4-prop-2-enylperoxybutoxy)phenyl]prop-2-enoyl]oxycyclohexyl] (E)-3-[3,4-bis(4-ethenoxybutoxy)-2-hexoxyphenyl]prop-2-enoate |
|---|---|
| PubChem CID | 58764659 |
| Molecular Formula | C62H92O16 |
| Molecular Weight | 1093.40 g/mol |
| Exact Mass | 1092.64 |
| IUPAC Name | [4-[(E)-3-[2-hexoxy-3,4-bis(4-prop-2-enylperoxybutoxy)phenyl]prop-2-enoyl]oxycyclohexyl] (E)-3-[3,4-bis(4-ethenoxybutoxy)-2-hexoxyphenyl]prop-2-enoate |
| SMILES | C=CCOOCCCCOc1ccc(/C=C/C(=O)OC2CCC(OC(=O)/C=C/c3ccc(OCCCCOC=C)c(OCCCCOC=C)c3OCCCCCC)CC2)c(OCCCCCC)c1OCCCCOOCC=C |
| InChI | InChI=1S/C62H92O16/c1-7-13-15-17-45-69-59-51(27-35-55(67-43-21-19-41-65-11-5)61(59)71-47-22-20-42-66-12-6)29-37-57(63)77-53-31-33-54(34-32-53)78-58(64)38-30-52-28-36-56(68-44-23-25-49-75-73-39-9-3)62(60(52)70-46-18-16-14-8-2)72-48-24-26-50-76-74-40-10-4/h9-12,27-30,35-38,53-54H,3-8,13-26,31-34,39-50H2,1-2H3/b37-29+,38-30+ |
| InChIKey | HIRVHZJEKGMRSH-UDEUAJILSA-N |
| XLogP | 13.95 |
| TPSA | 163.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 78 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1093.40 |
| LogP ≤ 5 | 13.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|