C67H78N2O12 — CID 91009408
bis[4-[4-[3-(4-hexoxyphenoxy)-3-oxoprop-1-enyl]phenoxy]butyl] 2,2-bis[(4-aminophenyl)methyl]propanedioate (PubChem CID 91009408) has the molecular formula C67H78N2O12 and a molecular weight of 1103.36 g/mol. Its IUPAC name is bis[4-[4-[3-(4-hexoxyphenoxy)-3-oxoprop-1-enyl]phenoxy]butyl] 2,2-bis[(4-aminophenyl)methyl]propanedioate.
| Compound Name | bis[4-[4-[3-(4-hexoxyphenoxy)-3-oxoprop-1-enyl]phenoxy]butyl] 2,2-bis[(4-aminophenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 91009408 |
| Molecular Formula | C67H78N2O12 |
| Molecular Weight | 1103.36 g/mol |
| Exact Mass | 1102.56 |
| IUPAC Name | bis[4-[4-[3-(4-hexoxyphenoxy)-3-oxoprop-1-enyl]phenoxy]butyl] 2,2-bis[(4-aminophenyl)methyl]propanedioate |
| SMILES | CCCCCCOc1ccc(OC(=O)C=Cc2ccc(OCCCCOC(=O)C(Cc3ccc(N)cc3)(Cc3ccc(N)cc3)C(=O)OCCCCOc3ccc(C=CC(=O)Oc4ccc(OCCCCCC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C67H78N2O12/c1-3-5-7-9-43-74-59-33-37-61(38-34-59)80-63(70)41-23-51-19-29-57(30-20-51)76-45-11-13-47-78-65(72)67(49-53-15-25-55(68)26-16-53,50-54-17-27-56(69)28-18-54)66(73)79-48-14-12-46-77-58-31-21-52(22-32-58)24-42-64(71)81-62-39-35-60(36-40-62)75-44-10-8-6-4-2/h15-42H,3-14,43-50,68-69H2,1-2H3 |
| InChIKey | QTVRBBOUVVAATQ-UHFFFAOYSA-N |
| XLogP | 13.58 |
| TPSA | 194.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1103.36 |
| LogP ≤ 5 | 13.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|