C23H31NO3 — CID 70634886
3-(4-aminophenyl)prop-2-enoic acid;1-ethyl-4-hexoxybenzene (PubChem CID 70634886) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is 3-(4-aminophenyl)prop-2-enoic acid;1-ethyl-4-hexoxybenzene.
| Compound Name | 3-(4-aminophenyl)prop-2-enoic acid;1-ethyl-4-hexoxybenzene |
|---|---|
| PubChem CID | 70634886 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 3-(4-aminophenyl)prop-2-enoic acid;1-ethyl-4-hexoxybenzene |
| SMILES | CCCCCCOc1ccc(CC)cc1.Nc1ccc(C=CC(=O)O)cc1 |
| InChI | InChI=1S/C14H22O.C9H9NO2/c1-3-5-6-7-12-15-14-10-8-13(4-2)9-11-14;10-8-4-1-7(2-5-8)3-6-9(11)12/h8-11H,3-7,12H2,1-2H3;1-6H,10H2,(H,11,12) |
| InChIKey | DZSQLESFMHOREV-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|