C41H58O7 — CID 101126500
diheptyl 2-[[4-[(E)-3-(4-octoxyphenyl)prop-2-enoyl]oxyphenyl]methylidene]propanedioate (PubChem CID 101126500) has the molecular formula C41H58O7 and a molecular weight of 662.91 g/mol. Its IUPAC name is diheptyl 2-[[4-[(E)-3-(4-octoxyphenyl)prop-2-enoyl]oxyphenyl]methylidene]propanedioate.
| Compound Name | diheptyl 2-[[4-[(E)-3-(4-octoxyphenyl)prop-2-enoyl]oxyphenyl]methylidene]propanedioate |
|---|---|
| PubChem CID | 101126500 |
| Molecular Formula | C41H58O7 |
| Molecular Weight | 662.91 g/mol |
| Exact Mass | 662.42 |
| IUPAC Name | diheptyl 2-[[4-[(E)-3-(4-octoxyphenyl)prop-2-enoyl]oxyphenyl]methylidene]propanedioate |
| SMILES | CCCCCCCCOc1ccc(/C=C/C(=O)Oc2ccc(C=C(C(=O)OCCCCCCC)C(=O)OCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C41H58O7/c1-4-7-10-13-16-17-30-45-36-25-20-34(21-26-36)24-29-39(42)48-37-27-22-35(23-28-37)33-38(40(43)46-31-18-14-11-8-5-2)41(44)47-32-19-15-12-9-6-3/h20-29,33H,4-19,30-32H2,1-3H3/b29-24+ |
| InChIKey | WCHBKKLCHOLHPF-RMLRFSFXSA-N |
| XLogP | 10.46 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.91 |
| LogP ≤ 5 | 10.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|