C70H100O12 — CID 102208755
bis[4-(3-decoxy-2-decoxycarbonyl-3-oxoprop-1-enyl)phenyl] cubane-1,4-dicarboxylate (PubChem CID 102208755) has the molecular formula C70H100O12 and a molecular weight of 1133.56 g/mol. Its IUPAC name is bis[4-(3-decoxy-2-decoxycarbonyl-3-oxoprop-1-enyl)phenyl] cubane-1,4-dicarboxylate.
| Compound Name | bis[4-(3-decoxy-2-decoxycarbonyl-3-oxoprop-1-enyl)phenyl] cubane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 102208755 |
| Molecular Formula | C70H100O12 |
| Molecular Weight | 1133.56 g/mol |
| Exact Mass | 1132.72 |
| IUPAC Name | bis[4-(3-decoxy-2-decoxycarbonyl-3-oxoprop-1-enyl)phenyl] cubane-1,4-dicarboxylate |
| SMILES | CCCCCCCCCCOC(=O)C(=Cc1ccc(OC(=O)C23C4C5C2C2C3C4C52C(=O)Oc2ccc(C=C(C(=O)OCCCCCCCCCC)C(=O)OCCCCCCCCCC)cc2)cc1)C(=O)OCCCCCCCCCC |
| InChI | InChI=1S/C70H100O12/c1-5-9-13-17-21-25-29-33-45-77-63(71)55(64(72)78-46-34-30-26-22-18-14-10-6-2)49-51-37-41-53(42-38-51)81-67(75)69-57-60-58(69)62-59(69)61(57)70(60,62)68(76)82-54-43-39-52(40-44-54)50-56(65(73)79-47-35-31-27-23-19-15-11-7-3)66(74)80-48-36-32-28-24-20-16-12-8-4/h37-44,49-50,57-62H,5-36,45-48H2,1-4H3 |
| InChIKey | VZDDDDJAPRYIQP-UHFFFAOYSA-N |
| XLogP | 16.44 |
| TPSA | 157.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1133.56 |
| LogP ≤ 5 | 16.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|