C32H36O6 — CID 102384297
bis(4-pentoxyphenyl) pentacyclo[3.3.0.02,4.03,7.06,8]octane-2,6-dicarboxylate (PubChem CID 102384297) has the molecular formula C32H36O6 and a molecular weight of 516.63 g/mol. Its IUPAC name is bis(4-pentoxyphenyl) pentacyclo[3.3.0.02,4.03,7.06,8]octane-2,6-dicarboxylate.
| Compound Name | bis(4-pentoxyphenyl) pentacyclo[3.3.0.02,4.03,7.06,8]octane-2,6-dicarboxylate |
|---|---|
| PubChem CID | 102384297 |
| Molecular Formula | C32H36O6 |
| Molecular Weight | 516.63 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | bis(4-pentoxyphenyl) pentacyclo[3.3.0.02,4.03,7.06,8]octane-2,6-dicarboxylate |
| SMILES | CCCCCOc1ccc(OC(=O)C23C4C2C2C5C3C4C52C(=O)Oc2ccc(OCCCCC)cc2)cc1 |
| InChI | InChI=1S/C32H36O6/c1-3-5-7-17-35-19-9-13-21(14-10-19)37-29(33)31-23-25(31)26-24-27(31)28(23)32(24,26)30(34)38-22-15-11-20(12-16-22)36-18-8-6-4-2/h9-16,23-28H,3-8,17-18H2,1-2H3 |
| InChIKey | JCCACSQLSICCOX-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.63 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|