C26H28O8 — CID 171158859
4-[4-(3-butoxy-2-butoxycarbonyl-3-oxoprop-1-enyl)benzoyl]oxybenzoic acid (PubChem CID 171158859) has the molecular formula C26H28O8 and a molecular weight of 468.50 g/mol. Its IUPAC name is 4-[4-(3-butoxy-2-butoxycarbonyl-3-oxoprop-1-enyl)benzoyl]oxybenzoic acid.
| Compound Name | 4-[4-(3-butoxy-2-butoxycarbonyl-3-oxoprop-1-enyl)benzoyl]oxybenzoic acid |
|---|---|
| PubChem CID | 171158859 |
| Molecular Formula | C26H28O8 |
| Molecular Weight | 468.50 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 4-[4-(3-butoxy-2-butoxycarbonyl-3-oxoprop-1-enyl)benzoyl]oxybenzoic acid |
| SMILES | CCCCOC(=O)C(=Cc1ccc(C(=O)Oc2ccc(C(=O)O)cc2)cc1)C(=O)OCCCC |
| InChI | InChI=1S/C26H28O8/c1-3-5-15-32-25(30)22(26(31)33-16-6-4-2)17-18-7-9-20(10-8-18)24(29)34-21-13-11-19(12-14-21)23(27)28/h7-14,17H,3-6,15-16H2,1-2H3,(H,27,28) |
| InChIKey | KEQOIFOQRDRSQN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|