C69H82N2O12 — CID 173090656
2-[7-(4-aminophenyl)-1,13-bis[4-[3-oxo-3-(4-pentoxyphenoxy)prop-1-enyl]phenoxy]tridecan-7-yl]-2-[(4-aminophenyl)methyl]propanedioic acid (PubChem CID 173090656) has the molecular formula C69H82N2O12 and a molecular weight of 1131.42 g/mol. Its IUPAC name is 2-[7-(4-aminophenyl)-1,13-bis[4-[3-oxo-3-(4-pentoxyphenoxy)prop-1-enyl]phenoxy]tridecan-7-yl]-2-[(4-aminophenyl)methyl]propanedioic acid.
| Compound Name | 2-[7-(4-aminophenyl)-1,13-bis[4-[3-oxo-3-(4-pentoxyphenoxy)prop-1-enyl]phenoxy]tridecan-7-yl]-2-[(4-aminophenyl)methyl]propanedioic acid |
|---|---|
| PubChem CID | 173090656 |
| Molecular Formula | C69H82N2O12 |
| Molecular Weight | 1131.42 g/mol |
| Exact Mass | 1130.59 |
| IUPAC Name | 2-[7-(4-aminophenyl)-1,13-bis[4-[3-oxo-3-(4-pentoxyphenoxy)prop-1-enyl]phenoxy]tridecan-7-yl]-2-[(4-aminophenyl)methyl]propanedioic acid |
| SMILES | CCCCCOc1ccc(OC(=O)C=Cc2ccc(OCCCCCCC(CCCCCCOc3ccc(C=CC(=O)Oc4ccc(OCCCCC)cc4)cc3)(c3ccc(N)cc3)C(Cc3ccc(N)cc3)(C(=O)O)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C69H82N2O12/c1-3-5-13-47-78-60-35-39-62(40-36-60)82-64(72)43-23-52-19-31-58(32-20-52)80-49-15-9-7-11-45-68(55-25-29-57(71)30-26-55,69(66(74)75,67(76)77)51-54-17-27-56(70)28-18-54)46-12-8-10-16-50-81-59-33-21-53(22-34-59)24-44-65(73)83-63-41-37-61(38-42-63)79-48-14-6-4-2/h17-44H,3-16,45-51,70-71H2,1-2H3,(H,74,75)(H,76,77) |
| InChIKey | VZWWIJRPUFECFJ-UHFFFAOYSA-N |
| XLogP | 14.92 |
| TPSA | 216.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 83 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1131.42 |
| LogP ≤ 5 | 14.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|