C25H37N3O5Si — CID 102214393
3-[carbazol-9-yl(methyl)amino]propyl N-(2-triethoxysilylethyl)carbamate (PubChem CID 102214393) has the molecular formula C25H37N3O5Si and a molecular weight of 487.67 g/mol. Its IUPAC name is 3-[carbazol-9-yl(methyl)amino]propyl N-(2-triethoxysilylethyl)carbamate.
| Compound Name | 3-[carbazol-9-yl(methyl)amino]propyl N-(2-triethoxysilylethyl)carbamate |
|---|---|
| PubChem CID | 102214393 |
| Molecular Formula | C25H37N3O5Si |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | 3-[carbazol-9-yl(methyl)amino]propyl N-(2-triethoxysilylethyl)carbamate |
| SMILES | CCO[Si](CCNC(=O)OCCCN(C)n1c2ccccc2c2ccccc21)(OCC)OCC |
| InChI | InChI=1S/C25H37N3O5Si/c1-5-31-34(32-6-2,33-7-3)20-17-26-25(29)30-19-12-18-27(4)28-23-15-10-8-13-21(23)22-14-9-11-16-24(22)28/h8-11,13-16H,5-7,12,17-20H2,1-4H3,(H,26,29) |
| InChIKey | KDKZSQNQNQLODT-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 74.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|