C31H42N2O5Si — CID 59065485
[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]methyl N-(3-triethoxysilylpropyl)carbamate (PubChem CID 59065485) has the molecular formula C31H42N2O5Si and a molecular weight of 550.77 g/mol. Its IUPAC name is [4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]methyl N-(3-triethoxysilylpropyl)carbamate.
| Compound Name | [4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]methyl N-(3-triethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 59065485 |
| Molecular Formula | C31H42N2O5Si |
| Molecular Weight | 550.77 g/mol |
| Exact Mass | 550.29 |
| IUPAC Name | [4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]methyl N-(3-triethoxysilylpropyl)carbamate |
| SMILES | CCO[Si](CCCNC(=O)OCc1ccc(N(c2ccc(C)cc2)c2ccc(C)cc2)cc1)(OCC)OCC |
| InChI | InChI=1S/C31H42N2O5Si/c1-6-36-39(37-7-2,38-8-3)23-9-22-32-31(34)35-24-27-14-20-30(21-15-27)33(28-16-10-25(4)11-17-28)29-18-12-26(5)13-19-29/h10-21H,6-9,22-24H2,1-5H3,(H,32,34) |
| InChIKey | UOSYFGAJLYYDOE-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.77 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|