C16H26BrNO6SSi — CID 67296718
[5-(bromomethylidene)-2-oxothiophen-3-yl]methyl N-(3-triethoxysilylpropyl)carbamate (PubChem CID 67296718) has the molecular formula C16H26BrNO6SSi and a molecular weight of 468.44 g/mol. Its IUPAC name is [5-(bromomethylidene)-2-oxothiophen-3-yl]methyl N-(3-triethoxysilylpropyl)carbamate.
| Compound Name | [5-(bromomethylidene)-2-oxothiophen-3-yl]methyl N-(3-triethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 67296718 |
| Molecular Formula | C16H26BrNO6SSi |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 467.04 |
| IUPAC Name | [5-(bromomethylidene)-2-oxothiophen-3-yl]methyl N-(3-triethoxysilylpropyl)carbamate |
| SMILES | CCO[Si](CCCNC(=O)OCC1=CC(=CBr)SC1=O)(OCC)OCC |
| InChI | InChI=1S/C16H26BrNO6SSi/c1-4-22-26(23-5-2,24-6-3)9-7-8-18-16(20)21-12-13-10-14(11-17)25-15(13)19/h10-11H,4-9,12H2,1-3H3,(H,18,20) |
| InChIKey | PBHFGIGHRMXCDO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|