C15H26N2O5Si — CID 59228638
pyridin-2-yl N-(3-triethoxysilylpropyl)carbamate (PubChem CID 59228638) has the molecular formula C15H26N2O5Si and a molecular weight of 342.47 g/mol. Its IUPAC name is pyridin-2-yl N-(3-triethoxysilylpropyl)carbamate.
| Compound Name | pyridin-2-yl N-(3-triethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 59228638 |
| Molecular Formula | C15H26N2O5Si |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | pyridin-2-yl N-(3-triethoxysilylpropyl)carbamate |
| SMILES | CCO[Si](CCCNC(=O)Oc1ccccn1)(OCC)OCC |
| InChI | InChI=1S/C15H26N2O5Si/c1-4-19-23(20-5-2,21-6-3)13-9-12-17-15(18)22-14-10-7-8-11-16-14/h7-8,10-11H,4-6,9,12-13H2,1-3H3,(H,17,18) |
| InChIKey | JHIRVBMPKFJLTF-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|