C19H34N2O4Si — CID 175303138
1-(2-phenylethyl)-3-(4-triethoxysilylbutyl)urea (PubChem CID 175303138) has the molecular formula C19H34N2O4Si and a molecular weight of 382.58 g/mol. Its IUPAC name is 1-(2-phenylethyl)-3-(4-triethoxysilylbutyl)urea.
| Compound Name | 1-(2-phenylethyl)-3-(4-triethoxysilylbutyl)urea |
|---|---|
| PubChem CID | 175303138 |
| Molecular Formula | C19H34N2O4Si |
| Molecular Weight | 382.58 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | 1-(2-phenylethyl)-3-(4-triethoxysilylbutyl)urea |
| SMILES | CCO[Si](CCCCNC(=O)NCCc1ccccc1)(OCC)OCC |
| InChI | InChI=1S/C19H34N2O4Si/c1-4-23-26(24-5-2,25-6-3)17-11-10-15-20-19(22)21-16-14-18-12-8-7-9-13-18/h7-9,12-13H,4-6,10-11,14-17H2,1-3H3,(H2,20,21,22) |
| InChIKey | UYGKQPPPHKYAOE-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.58 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|