C16H29NO5SSi — CID 68511239
1-phenyl-N-(3-triethoxysilylpropyl)methanesulfonamide (PubChem CID 68511239) has the molecular formula C16H29NO5SSi and a molecular weight of 375.56 g/mol. Its IUPAC name is 1-phenyl-N-(3-triethoxysilylpropyl)methanesulfonamide.
| Compound Name | 1-phenyl-N-(3-triethoxysilylpropyl)methanesulfonamide |
|---|---|
| PubChem CID | 68511239 |
| Molecular Formula | C16H29NO5SSi |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.15 |
| IUPAC Name | 1-phenyl-N-(3-triethoxysilylpropyl)methanesulfonamide |
| SMILES | CCO[Si](CCCNS(=O)(=O)Cc1ccccc1)(OCC)OCC |
| InChI | InChI=1S/C16H29NO5SSi/c1-4-20-24(21-5-2,22-6-3)14-10-13-17-23(18,19)15-16-11-8-7-9-12-16/h7-9,11-12,17H,4-6,10,13-15H2,1-3H3 |
| InChIKey | FHRRDWAWYIMLJW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|