C22H23NO2S — CID 19680983
N-(3,3-diphenylpropyl)-1-phenylmethanesulfonamide (PubChem CID 19680983) has the molecular formula C22H23NO2S and a molecular weight of 365.50 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-1-phenylmethanesulfonamide.
| Compound Name | N-(3,3-diphenylpropyl)-1-phenylmethanesulfonamide |
|---|---|
| PubChem CID | 19680983 |
| Molecular Formula | C22H23NO2S |
| Molecular Weight | 365.50 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-(3,3-diphenylpropyl)-1-phenylmethanesulfonamide |
| SMILES | O=S(=O)(Cc1ccccc1)NCCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H23NO2S/c24-26(25,18-19-10-4-1-5-11-19)23-17-16-22(20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-15,22-23H,16-18H2 |
| InChIKey | CRXBEYOVLUTYGZ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |