C24H27NO4S — CID 90518427
N-(3,3-diphenylpropyl)-2-(4-methoxyphenoxy)ethanesulfonamide (PubChem CID 90518427) has the molecular formula C24H27NO4S and a molecular weight of 425.55 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-2-(4-methoxyphenoxy)ethanesulfonamide.
| Compound Name | N-(3,3-diphenylpropyl)-2-(4-methoxyphenoxy)ethanesulfonamide |
|---|---|
| PubChem CID | 90518427 |
| Molecular Formula | C24H27NO4S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | N-(3,3-diphenylpropyl)-2-(4-methoxyphenoxy)ethanesulfonamide |
| SMILES | COc1ccc(OCCS(=O)(=O)NCCC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H27NO4S/c1-28-22-12-14-23(15-13-22)29-18-19-30(26,27)25-17-16-24(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-15,24-25H,16-19H2,1H3 |
| InChIKey | JPVXHQZAMJKWFI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |