C23H25NO3S — CID 7938232
N-(3,3-diphenylpropyl)-4-ethoxybenzenesulfonamide (PubChem CID 7938232) has the molecular formula C23H25NO3S and a molecular weight of 395.52 g/mol. Its IUPAC name is N-(3,3-diphenylpropyl)-4-ethoxybenzenesulfonamide.
| Compound Name | N-(3,3-diphenylpropyl)-4-ethoxybenzenesulfonamide |
|---|---|
| PubChem CID | 7938232 |
| Molecular Formula | C23H25NO3S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | N-(3,3-diphenylpropyl)-4-ethoxybenzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NCCC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H25NO3S/c1-2-27-21-13-15-22(16-14-21)28(25,26)24-18-17-23(19-9-5-3-6-10-19)20-11-7-4-8-12-20/h3-16,23-24H,2,17-18H2,1H3 |
| InChIKey | WUXGNYYBJLIMET-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |