C15H26N2O3S — CID 119972668
N-(3-aminobutyl)-4-(3-methylbutoxy)benzenesulfonamide (PubChem CID 119972668) has the molecular formula C15H26N2O3S and a molecular weight of 314.45 g/mol. Its IUPAC name is N-(3-aminobutyl)-4-(3-methylbutoxy)benzenesulfonamide.
| Compound Name | N-(3-aminobutyl)-4-(3-methylbutoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 119972668 |
| Molecular Formula | C15H26N2O3S |
| Molecular Weight | 314.45 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | N-(3-aminobutyl)-4-(3-methylbutoxy)benzenesulfonamide |
| SMILES | CC(C)CCOc1ccc(S(=O)(=O)NCCC(C)N)cc1 |
| InChI | InChI=1S/C15H26N2O3S/c1-12(2)9-11-20-14-4-6-15(7-5-14)21(18,19)17-10-8-13(3)16/h4-7,12-13,17H,8-11,16H2,1-3H3 |
| InChIKey | HXYCDWNFEJWXFE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.45 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |