C14H23NO4S — CID 64913130
N-(3-hydroxybutyl)-4-(2-methylpropoxy)benzenesulfonamide (PubChem CID 64913130) has the molecular formula C14H23NO4S and a molecular weight of 301.41 g/mol. Its IUPAC name is N-(3-hydroxybutyl)-4-(2-methylpropoxy)benzenesulfonamide.
| Compound Name | N-(3-hydroxybutyl)-4-(2-methylpropoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 64913130 |
| Molecular Formula | C14H23NO4S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | N-(3-hydroxybutyl)-4-(2-methylpropoxy)benzenesulfonamide |
| SMILES | CC(C)COc1ccc(S(=O)(=O)NCCC(C)O)cc1 |
| InChI | InChI=1S/C14H23NO4S/c1-11(2)10-19-13-4-6-14(7-5-13)20(17,18)15-9-8-12(3)16/h4-7,11-12,15-16H,8-10H2,1-3H3 |
| InChIKey | YGTZSSCRXPJUBL-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |