C14H24N2O3S — CID 62663335
N-[2-(ethylamino)ethyl]-4-(2-methylpropoxy)benzenesulfonamide (PubChem CID 62663335) has the molecular formula C14H24N2O3S and a molecular weight of 300.42 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-4-(2-methylpropoxy)benzenesulfonamide.
| Compound Name | N-[2-(ethylamino)ethyl]-4-(2-methylpropoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 62663335 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-4-(2-methylpropoxy)benzenesulfonamide |
| SMILES | CCNCCNS(=O)(=O)c1ccc(OCC(C)C)cc1 |
| InChI | InChI=1S/C14H24N2O3S/c1-4-15-9-10-16-20(17,18)14-7-5-13(6-8-14)19-11-12(2)3/h5-8,12,15-16H,4,9-11H2,1-3H3 |
| InChIKey | IWJLPIALUGTWHO-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|