C12H18F3N3O4S2 — CID 119973745
1-N-[2-(ethylamino)ethyl]-4-N-(2,2,2-trifluoroethyl)benzene-1,4-disulfonamide (PubChem CID 119973745) has the molecular formula C12H18F3N3O4S2 and a molecular weight of 389.42 g/mol. Its IUPAC name is 1-N-[2-(ethylamino)ethyl]-4-N-(2,2,2-trifluoroethyl)benzene-1,4-disulfonamide.
| Compound Name | 1-N-[2-(ethylamino)ethyl]-4-N-(2,2,2-trifluoroethyl)benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 119973745 |
| Molecular Formula | C12H18F3N3O4S2 |
| Molecular Weight | 389.42 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 1-N-[2-(ethylamino)ethyl]-4-N-(2,2,2-trifluoroethyl)benzene-1,4-disulfonamide |
| SMILES | CCNCCNS(=O)(=O)c1ccc(S(=O)(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H18F3N3O4S2/c1-2-16-7-8-17-23(19,20)10-3-5-11(6-4-10)24(21,22)18-9-12(13,14)15/h3-6,16-18H,2,7-9H2,1H3 |
| InChIKey | WLEPWQMEWOUPCY-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.42 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|