C12H17F3N2O2S — CID 60821922
4-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)benzenesulfonamide (PubChem CID 60821922) has the molecular formula C12H17F3N2O2S and a molecular weight of 310.34 g/mol. Its IUPAC name is 4-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)benzenesulfonamide.
| Compound Name | 4-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 60821922 |
| Molecular Formula | C12H17F3N2O2S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 4-(propylaminomethyl)-N-(2,2,2-trifluoroethyl)benzenesulfonamide |
| SMILES | CCCNCc1ccc(S(=O)(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C12H17F3N2O2S/c1-2-7-16-8-10-3-5-11(6-4-10)20(18,19)17-9-12(13,14)15/h3-6,16-17H,2,7-9H2,1H3 |
| InChIKey | XPFPNJWWVHWQLF-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|