C12H16F4N2O2S — CID 106294662
4-(ethylaminomethyl)-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide (PubChem CID 106294662) has the molecular formula C12H16F4N2O2S and a molecular weight of 328.33 g/mol. Its IUPAC name is 4-(ethylaminomethyl)-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide.
| Compound Name | 4-(ethylaminomethyl)-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106294662 |
| Molecular Formula | C12H16F4N2O2S |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 4-(ethylaminomethyl)-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide |
| SMILES | CCNCc1ccc(S(=O)(=O)NCC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C12H16F4N2O2S/c1-2-17-7-9-3-5-10(6-4-9)21(19,20)18-8-12(15,16)11(13)14/h3-6,11,17-18H,2,7-8H2,1H3 |
| InChIKey | KBDGRSLJQIAJOG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|