C16H19FN2O2S — CID 28715741
4-(ethylaminomethyl)-N-[(4-fluorophenyl)methyl]benzenesulfonamide (PubChem CID 28715741) has the molecular formula C16H19FN2O2S and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-(ethylaminomethyl)-N-[(4-fluorophenyl)methyl]benzenesulfonamide.
| Compound Name | 4-(ethylaminomethyl)-N-[(4-fluorophenyl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 28715741 |
| Molecular Formula | C16H19FN2O2S |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 4-(ethylaminomethyl)-N-[(4-fluorophenyl)methyl]benzenesulfonamide |
| SMILES | CCNCc1ccc(S(=O)(=O)NCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C16H19FN2O2S/c1-2-18-11-13-5-9-16(10-6-13)22(20,21)19-12-14-3-7-15(17)8-4-14/h3-10,18-19H,2,11-12H2,1H3 |
| InChIKey | URVHNCWTXVAPLP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |