C10H8F4N2O2S — CID 103577915
4-cyano-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide (PubChem CID 103577915) has the molecular formula C10H8F4N2O2S and a molecular weight of 296.25 g/mol. Its IUPAC name is 4-cyano-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide.
| Compound Name | 4-cyano-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103577915 |
| Molecular Formula | C10H8F4N2O2S |
| Molecular Weight | 296.25 g/mol |
| Exact Mass | 296.02 |
| IUPAC Name | 4-cyano-N-(2,2,3,3-tetrafluoropropyl)benzenesulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NCC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C10H8F4N2O2S/c11-9(12)10(13,14)6-16-19(17,18)8-3-1-7(5-15)2-4-8/h1-4,9,16H,6H2 |
| InChIKey | WDZBUYNEBYCIEQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.25 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|