C9H8ClF4NO4S2 — CID 106292510
4-(2,2,3,3-tetrafluoropropylsulfamoyl)benzenesulfonyl chloride (PubChem CID 106292510) has the molecular formula C9H8ClF4NO4S2 and a molecular weight of 369.75 g/mol. Its IUPAC name is 4-(2,2,3,3-tetrafluoropropylsulfamoyl)benzenesulfonyl chloride.
| Compound Name | 4-(2,2,3,3-tetrafluoropropylsulfamoyl)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 106292510 |
| Molecular Formula | C9H8ClF4NO4S2 |
| Molecular Weight | 369.75 g/mol |
| Exact Mass | 368.95 |
| IUPAC Name | 4-(2,2,3,3-tetrafluoropropylsulfamoyl)benzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc(S(=O)(=O)NCC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C9H8ClF4NO4S2/c10-20(16,17)6-1-3-7(4-2-6)21(18,19)15-5-9(13,14)8(11)12/h1-4,8,15H,5H2 |
| InChIKey | OWUQKAHBIHJWPI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.75 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|