C8H7ClF4N2O3S — CID 106293639
5-chloro-6-oxo-N-(2,2,3,3-tetrafluoropropyl)-1H-pyridine-3-sulfonamide (PubChem CID 106293639) has the molecular formula C8H7ClF4N2O3S and a molecular weight of 322.67 g/mol. Its IUPAC name is 5-chloro-6-oxo-N-(2,2,3,3-tetrafluoropropyl)-1H-pyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-oxo-N-(2,2,3,3-tetrafluoropropyl)-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106293639 |
| Molecular Formula | C8H7ClF4N2O3S |
| Molecular Weight | 322.67 g/mol |
| Exact Mass | 321.98 |
| IUPAC Name | 5-chloro-6-oxo-N-(2,2,3,3-tetrafluoropropyl)-1H-pyridine-3-sulfonamide |
| SMILES | O=c1[nH]cc(S(=O)(=O)NCC(F)(F)C(F)F)cc1Cl |
| InChI | InChI=1S/C8H7ClF4N2O3S/c9-5-1-4(2-14-6(5)16)19(17,18)15-3-8(12,13)7(10)11/h1-2,7,15H,3H2,(H,14,16) |
| InChIKey | PAEJHIKJQYDCFC-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.67 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|