C8H12ClN3O5S2 — CID 64609049
5-chloro-6-oxo-N-(3-sulfamoylpropyl)-1H-pyridine-3-sulfonamide (PubChem CID 64609049) has the molecular formula C8H12ClN3O5S2 and a molecular weight of 329.79 g/mol. Its IUPAC name is 5-chloro-6-oxo-N-(3-sulfamoylpropyl)-1H-pyridine-3-sulfonamide.
| Compound Name | 5-chloro-6-oxo-N-(3-sulfamoylpropyl)-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64609049 |
| Molecular Formula | C8H12ClN3O5S2 |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 328.99 |
| IUPAC Name | 5-chloro-6-oxo-N-(3-sulfamoylpropyl)-1H-pyridine-3-sulfonamide |
| SMILES | NS(=O)(=O)CCCNS(=O)(=O)c1c[nH]c(=O)c(Cl)c1 |
| InChI | InChI=1S/C8H12ClN3O5S2/c9-7-4-6(5-11-8(7)13)19(16,17)12-2-1-3-18(10,14)15/h4-5,12H,1-3H2,(H,11,13)(H2,10,14,15) |
| InChIKey | JLDSHCDSRZLNDP-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 139.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|