C11H16ClN3O4S — CID 64608272
N-[2-[(5-chloro-6-oxo-1H-pyridin-3-yl)sulfonylamino]ethyl]-2-methylpropanamide (PubChem CID 64608272) has the molecular formula C11H16ClN3O4S and a molecular weight of 321.79 g/mol. Its IUPAC name is N-[2-[(5-chloro-6-oxo-1H-pyridin-3-yl)sulfonylamino]ethyl]-2-methylpropanamide.
| Compound Name | N-[2-[(5-chloro-6-oxo-1H-pyridin-3-yl)sulfonylamino]ethyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 64608272 |
| Molecular Formula | C11H16ClN3O4S |
| Molecular Weight | 321.79 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | N-[2-[(5-chloro-6-oxo-1H-pyridin-3-yl)sulfonylamino]ethyl]-2-methylpropanamide |
| SMILES | CC(C)C(=O)NCCNS(=O)(=O)c1c[nH]c(=O)c(Cl)c1 |
| InChI | InChI=1S/C11H16ClN3O4S/c1-7(2)10(16)13-3-4-15-20(18,19)8-5-9(12)11(17)14-6-8/h5-7,15H,3-4H2,1-2H3,(H,13,16)(H,14,17) |
| InChIKey | GZAVAOKEVBFWCF-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.79 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|