C8H9ClN2O5S — CID 64608093
2-[(5-chloro-6-oxo-1H-pyridin-3-yl)sulfonylamino]propanoic acid (PubChem CID 64608093) has the molecular formula C8H9ClN2O5S and a molecular weight of 280.69 g/mol. Its IUPAC name is 2-[(5-chloro-6-oxo-1H-pyridin-3-yl)sulfonylamino]propanoic acid.
| Compound Name | 2-[(5-chloro-6-oxo-1H-pyridin-3-yl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 64608093 |
| Molecular Formula | C8H9ClN2O5S |
| Molecular Weight | 280.69 g/mol |
| Exact Mass | 279.99 |
| IUPAC Name | 2-[(5-chloro-6-oxo-1H-pyridin-3-yl)sulfonylamino]propanoic acid |
| SMILES | CC(NS(=O)(=O)c1c[nH]c(=O)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C8H9ClN2O5S/c1-4(8(13)14)11-17(15,16)5-2-6(9)7(12)10-3-5/h2-4,11H,1H3,(H,10,12)(H,13,14) |
| InChIKey | HEZJZTCZUXLOKU-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.69 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |