C13H15ClN2O3S2 — CID 64609039
5-chloro-N-(2-methyl-1-thiophen-2-ylpropyl)-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 64609039) has the molecular formula C13H15ClN2O3S2 and a molecular weight of 346.86 g/mol. Its IUPAC name is 5-chloro-N-(2-methyl-1-thiophen-2-ylpropyl)-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | 5-chloro-N-(2-methyl-1-thiophen-2-ylpropyl)-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64609039 |
| Molecular Formula | C13H15ClN2O3S2 |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.02 |
| IUPAC Name | 5-chloro-N-(2-methyl-1-thiophen-2-ylpropyl)-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | CC(C)C(NS(=O)(=O)c1c[nH]c(=O)c(Cl)c1)c1cccs1 |
| InChI | InChI=1S/C13H15ClN2O3S2/c1-8(2)12(11-4-3-5-20-11)16-21(18,19)9-6-10(14)13(17)15-7-9/h3-8,12,16H,1-2H3,(H,15,17) |
| InChIKey | MCGMXUIFEDWAJM-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |