C11H15ClN2O5S — CID 64607131
methyl (2S)-2-[(5-chloro-6-oxo-1H-pyridin-3-yl)sulfonylamino]-3-methylbutanoate (PubChem CID 64607131) has the molecular formula C11H15ClN2O5S and a molecular weight of 322.77 g/mol. Its IUPAC name is methyl (2S)-2-[(5-chloro-6-oxo-1H-pyridin-3-yl)sulfonylamino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[(5-chloro-6-oxo-1H-pyridin-3-yl)sulfonylamino]-3-methylbutanoate |
|---|---|
| PubChem CID | 64607131 |
| Molecular Formula | C11H15ClN2O5S |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | methyl (2S)-2-[(5-chloro-6-oxo-1H-pyridin-3-yl)sulfonylamino]-3-methylbutanoate |
| SMILES | COC(=O)[C@@H](NS(=O)(=O)c1c[nH]c(=O)c(Cl)c1)C(C)C |
| InChI | InChI=1S/C11H15ClN2O5S/c1-6(2)9(11(16)19-3)14-20(17,18)7-4-8(12)10(15)13-5-7/h4-6,9,14H,1-3H3,(H,13,15)/t9-/m0/s1 |
| InChIKey | CKTGOPCEBBEEJV-VIFPVBQESA-N |
| XLogP | 0.50 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |