C9H13ClN2O4S — CID 83186740
5-chloro-N-(4-hydroxybutan-2-yl)-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 83186740) has the molecular formula C9H13ClN2O4S and a molecular weight of 280.73 g/mol. Its IUPAC name is 5-chloro-N-(4-hydroxybutan-2-yl)-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | 5-chloro-N-(4-hydroxybutan-2-yl)-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 83186740 |
| Molecular Formula | C9H13ClN2O4S |
| Molecular Weight | 280.73 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 5-chloro-N-(4-hydroxybutan-2-yl)-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | CC(CCO)NS(=O)(=O)c1c[nH]c(=O)c(Cl)c1 |
| InChI | InChI=1S/C9H13ClN2O4S/c1-6(2-3-13)12-17(15,16)7-4-8(10)9(14)11-5-7/h4-6,12-13H,2-3H2,1H3,(H,11,14) |
| InChIKey | JSBQJAUGIHOIGZ-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.73 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |