C8H10ClN3O4S — CID 64607870
2-[(5-chloro-6-oxo-1H-pyridin-3-yl)sulfonylamino]-N-methylacetamide (PubChem CID 64607870) has the molecular formula C8H10ClN3O4S and a molecular weight of 279.71 g/mol. Its IUPAC name is 2-[(5-chloro-6-oxo-1H-pyridin-3-yl)sulfonylamino]-N-methylacetamide.
| Compound Name | 2-[(5-chloro-6-oxo-1H-pyridin-3-yl)sulfonylamino]-N-methylacetamide |
|---|---|
| PubChem CID | 64607870 |
| Molecular Formula | C8H10ClN3O4S |
| Molecular Weight | 279.71 g/mol |
| Exact Mass | 279.01 |
| IUPAC Name | 2-[(5-chloro-6-oxo-1H-pyridin-3-yl)sulfonylamino]-N-methylacetamide |
| SMILES | CNC(=O)CNS(=O)(=O)c1c[nH]c(=O)c(Cl)c1 |
| InChI | InChI=1S/C8H10ClN3O4S/c1-10-7(13)4-12-17(15,16)5-2-6(9)8(14)11-3-5/h2-3,12H,4H2,1H3,(H,10,13)(H,11,14) |
| InChIKey | KXDVUKGLAJZNJI-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.71 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |