C11H18ClN3O4S — CID 106149451
5-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 106149451) has the molecular formula C11H18ClN3O4S and a molecular weight of 323.80 g/mol. Its IUPAC name is 5-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | 5-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106149451 |
| Molecular Formula | C11H18ClN3O4S |
| Molecular Weight | 323.80 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 5-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | CN(C)CC(C)(O)CNS(=O)(=O)c1c[nH]c(=O)c(Cl)c1 |
| InChI | InChI=1S/C11H18ClN3O4S/c1-11(17,7-15(2)3)6-14-20(18,19)8-4-9(12)10(16)13-5-8/h4-5,14,17H,6-7H2,1-3H3,(H,13,16) |
| InChIKey | FYEPMBKTXXDZCD-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 102.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.80 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |