C13H22ClN3O3S — CID 106140330
5-amino-4-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-2-methylbenzenesulfonamide (PubChem CID 106140330) has the molecular formula C13H22ClN3O3S and a molecular weight of 335.86 g/mol. Its IUPAC name is 5-amino-4-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-2-methylbenzenesulfonamide.
| Compound Name | 5-amino-4-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106140330 |
| Molecular Formula | C13H22ClN3O3S |
| Molecular Weight | 335.86 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 5-amino-4-chloro-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(Cl)c(N)cc1S(=O)(=O)NCC(C)(O)CN(C)C |
| InChI | InChI=1S/C13H22ClN3O3S/c1-9-5-10(14)11(15)6-12(9)21(19,20)16-7-13(2,18)8-17(3)4/h5-6,16,18H,7-8,15H2,1-4H3 |
| InChIKey | XGFBRCZSAPZTEK-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.86 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|