C12H20BrN3O3S — CID 106140415
5-amino-2-bromo-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]benzenesulfonamide (PubChem CID 106140415) has the molecular formula C12H20BrN3O3S and a molecular weight of 366.28 g/mol. Its IUPAC name is 5-amino-2-bromo-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]benzenesulfonamide.
| Compound Name | 5-amino-2-bromo-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 106140415 |
| Molecular Formula | C12H20BrN3O3S |
| Molecular Weight | 366.28 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | 5-amino-2-bromo-N-[3-(dimethylamino)-2-hydroxy-2-methylpropyl]benzenesulfonamide |
| SMILES | CN(C)CC(C)(O)CNS(=O)(=O)c1cc(N)ccc1Br |
| InChI | InChI=1S/C12H20BrN3O3S/c1-12(17,8-16(2)3)7-15-20(18,19)11-6-9(14)4-5-10(11)13/h4-6,15,17H,7-8,14H2,1-3H3 |
| InChIKey | AMILZXAUXCDPCH-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.28 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|