C12H19ClN4O3S — CID 83108751
3-[2-[(5-amino-4-chloro-2-methylphenyl)sulfonylamino]ethyl]-1,1-dimethylurea (PubChem CID 83108751) has the molecular formula C12H19ClN4O3S and a molecular weight of 334.83 g/mol. Its IUPAC name is 3-[2-[(5-amino-4-chloro-2-methylphenyl)sulfonylamino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(5-amino-4-chloro-2-methylphenyl)sulfonylamino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83108751 |
| Molecular Formula | C12H19ClN4O3S |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 3-[2-[(5-amino-4-chloro-2-methylphenyl)sulfonylamino]ethyl]-1,1-dimethylurea |
| SMILES | Cc1cc(Cl)c(N)cc1S(=O)(=O)NCCNC(=O)N(C)C |
| InChI | InChI=1S/C12H19ClN4O3S/c1-8-6-9(13)10(14)7-11(8)21(19,20)16-5-4-15-12(18)17(2)3/h6-7,16H,4-5,14H2,1-3H3,(H,15,18) |
| InChIKey | BCZVAHOONOKBMK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|