C10H15ClN4O4S — CID 83114327
3-[2-[(5-chloro-6-oxo-1H-pyridin-3-yl)sulfonylamino]ethyl]-1,1-dimethylurea (PubChem CID 83114327) has the molecular formula C10H15ClN4O4S and a molecular weight of 322.77 g/mol. Its IUPAC name is 3-[2-[(5-chloro-6-oxo-1H-pyridin-3-yl)sulfonylamino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(5-chloro-6-oxo-1H-pyridin-3-yl)sulfonylamino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83114327 |
| Molecular Formula | C10H15ClN4O4S |
| Molecular Weight | 322.77 g/mol |
| Exact Mass | 322.05 |
| IUPAC Name | 3-[2-[(5-chloro-6-oxo-1H-pyridin-3-yl)sulfonylamino]ethyl]-1,1-dimethylurea |
| SMILES | CN(C)C(=O)NCCNS(=O)(=O)c1c[nH]c(=O)c(Cl)c1 |
| InChI | InChI=1S/C10H15ClN4O4S/c1-15(2)10(17)12-3-4-14-20(18,19)7-5-8(11)9(16)13-6-7/h5-6,14H,3-4H2,1-2H3,(H,12,17)(H,13,16) |
| InChIKey | OKKGHEBBQBMVPU-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 111.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.77 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|